LM87 series are LM8 series high pressure balance single-seat valve products, one of two basic sleeve widespread guidance, pressure balance type high-pressure single-seat valves, with separate sleeve structure, using high-performance metal sealing ring seal, with good dynamic stability under high temperature and high pressure, high control precision, allow the pressure difference is big, the operating force is small, large flow capacity, etc. Suitable for fluid control of harsh working conditions.
TECHNICAL PARAMETERS
| Nominal Size | DN40 ~ DN300 |
| Pressure Rating | PN/160/250/CL900(PN150)/1500(PN260)/2500(PN420) |
| Operateing Temperature | -196℃~ 593℃ |
| Characteristics | Equal percentage, linear, quickly open |
| Rangeability | 50:1 |
| Seat Leakage Class | ANSI B16.104: IV、V、VI |
| Body Material | WCB/WCC/LCB/LCC;WC6/WC9;CF8/CF8M;4A/5A etc. |
| Trim Material | 630/316/316+ST/316nitriding/316+Ni60/316+WC etc. |
| Seal Material | Flexible graphite ring packing, graphite +PTFE braided packing etc. |
Headquarter Add.: SUPCON Park, No.309 Liuhe Road, Binjiang District, Hangzhou, 310053, China.
Tel.: +86 571 8111 9774
Fax: +86 571 8111 9737
E-mail: info@supconvalve.com
